C12H22N3O7P — CID 71482634
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-pentyltriazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71482634) has the molecular formula C12H22N3O7P and a molecular weight of 351.30 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-pentyltriazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-pentyltriazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71482634 |
| Molecular Formula | C12H22N3O7P |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(4-pentyltriazol-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCc1cn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C12H22N3O7P/c1-2-3-4-5-8-6-15(14-13-8)12-11(17)10(16)9(22-12)7-21-23(18,19)20/h6,9-12,16-17H,2-5,7H2,1H3,(H2,18,19,20)/t9-,10-,11-,12-/m1/s1 |
| InChIKey | UTRNJSRAPRTMFG-DDHJBXDOSA-N |
| XLogP | -0.26 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|