C14H27N3O16P2 — CID 71530448
[(2R,3S,4R,5S)-2-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]triazol-4-yl]methoxy]-3,4,5,6-tetrahydroxyhexyl] dihydrogen phosphate (PubChem CID 71530448) has the molecular formula C14H27N3O16P2 and a molecular weight of 555.32 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-2-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]triazol-4-yl]methoxy]-3,4,5,6-tetrahydroxyhexyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5S)-2-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]triazol-4-yl]methoxy]-3,4,5,6-tetrahydroxyhexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71530448 |
| Molecular Formula | C14H27N3O16P2 |
| Molecular Weight | 555.32 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | [(2R,3S,4R,5S)-2-[[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]triazol-4-yl]methoxy]-3,4,5,6-tetrahydroxyhexyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](n2cc(CO[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H](O)CO)nn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H27N3O16P2/c18-2-7(19)10(20)11(21)8(4-31-34(24,25)26)30-3-6-1-17(16-15-6)14-13(23)12(22)9(33-14)5-32-35(27,28)29/h1,7-14,18-23H,2-5H2,(H2,24,25,26)(H2,27,28,29)/t7-,8+,9+,10+,11+,12+,13+,14+/m0/s1 |
| InChIKey | LTBZPBAOIHELGX-DMSCZLKBSA-N |
| XLogP | -4.92 |
| TPSA | 304.07 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.32 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|