C9H13N2O9PS — CID 57291035
[(2S,5S)-5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 57291035) has the molecular formula C9H13N2O9PS and a molecular weight of 356.25 g/mol. Its IUPAC name is [(2S,5S)-5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,5S)-5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 57291035 |
| Molecular Formula | C9H13N2O9PS |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | [(2S,5S)-5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2O[C@@H](COP(=O)(O)O)C(O)C2O)cc1S |
| InChI | InChI=1S/C9H13N2O9PS/c12-5-3(2-19-21(16,17)18)20-8(6(5)13)11-1-4(22)7(14)10-9(11)15/h1,3,5-6,8,12-13,22H,2H2,(H,10,14,15)(H2,16,17,18)/t3-,5?,6?,8-/m0/s1 |
| InChIKey | CNZHSMAVJXLLPA-JGGVSSGJSA-N |
| XLogP | -2.45 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|