C15H16ClN2O9P — CID 102478580
[(2R,3S,4R,5R)-5-[5-(4-chlorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 102478580) has the molecular formula C15H16ClN2O9P and a molecular weight of 434.73 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-(4-chlorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-(4-chlorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 102478580 |
| Molecular Formula | C15H16ClN2O9P |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-(4-chlorophenyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN2O9P/c16-8-3-1-7(2-4-8)9-5-18(15(22)17-13(9)21)14-12(20)11(19)10(27-14)6-26-28(23,24)25/h1-5,10-12,14,19-20H,6H2,(H,17,21,22)(H2,23,24,25)/t10-,11-,12-,14-/m1/s1 |
| InChIKey | DEUIBYQVAPOXSJ-HKUMRIAESA-N |
| XLogP | -0.41 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|