C16H19N2O10P — CID 71813014
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71813014) has the molecular formula C16H19N2O10P and a molecular weight of 430.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71813014 |
| Molecular Formula | C16H19N2O10P |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COc1ccc(-c2cn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H19N2O10P/c1-26-9-4-2-8(3-5-9)10-6-18(16(22)17-14(10)21)15-13(20)12(19)11(28-15)7-27-29(23,24)25/h2-6,11-13,15,19-20H,7H2,1H3,(H,17,21,22)(H2,23,24,25)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | UFLLHMVOBPSREP-RGCMKSIDSA-N |
| XLogP | -1.06 |
| TPSA | 180.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|