C16H16F3N2O9P — CID 71812842
[(2R,3S,4R,5R)-5-[2,4-dioxo-5-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71812842) has the molecular formula C16H16F3N2O9P and a molecular weight of 468.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2,4-dioxo-5-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[2,4-dioxo-5-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71812842 |
| Molecular Formula | C16H16F3N2O9P |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2,4-dioxo-5-[4-(trifluoromethyl)phenyl]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)cc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H16F3N2O9P/c17-16(18,19)8-3-1-7(2-4-8)9-5-21(15(25)20-13(9)24)14-12(23)11(22)10(30-14)6-29-31(26,27)28/h1-5,10-12,14,22-23H,6H2,(H,20,24,25)(H2,26,27,28)/t10-,11-,12-,14-/m1/s1 |
| InChIKey | DYZDZPAVZZBMJR-HKUMRIAESA-N |
| XLogP | -0.05 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|