C10H14F3N2O14P3S — CID 118152292
[[(2R,4S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate (PubChem CID 118152292) has the molecular formula C10H14F3N2O14P3S and a molecular weight of 568.21 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118152292 |
| Molecular Formula | C10H14F3N2O14P3S |
| Molecular Weight | 568.21 g/mol |
| Exact Mass | 567.93 |
| IUPAC Name | [[(2R,4S,5R)-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](COP(O)(=S)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]2O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H14F3N2O14P3S/c11-10(12,13)3-1-15(9(19)14-7(3)18)8-6(17)5(16)4(27-8)2-26-32(25,33)29-31(23,24)28-30(20,21)22/h1,4-6,8,16-17H,2H2,(H,23,24)(H,25,33)(H,14,18,19)(H2,20,21,22)/t4-,5?,6+,8-,32?/m1/s1 |
| InChIKey | KXSKPLDFGYCYDF-NXDAJZNTSA-N |
| XLogP | -1.37 |
| TPSA | 247.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|