C13H19F3N3O16P3 — CID 90230849
[[(2R,4S,5R)-3,4-dihydroxy-5-[5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90230849) has the molecular formula C13H19F3N3O16P3 and a molecular weight of 623.22 g/mol. Its IUPAC name is [[(2R,4S,5R)-3,4-dihydroxy-5-[5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-3,4-dihydroxy-5-[5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90230849 |
| Molecular Formula | C13H19F3N3O16P3 |
| Molecular Weight | 623.22 g/mol |
| Exact Mass | 622.99 |
| IUPAC Name | [[(2R,4S,5R)-3,4-dihydroxy-5-[5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CN(Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]2O)c(=O)[nH]c1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N3O16P3/c1-18(11(23)13(14,15)16)2-5-3-19(12(24)17-9(5)22)10-8(21)7(20)6(33-10)4-32-37(28,29)35-38(30,31)34-36(25,26)27/h3,6-8,10,20-21H,2,4H2,1H3,(H,28,29)(H,30,31)(H,17,22,24)(H2,25,26,27)/t6-,7?,8+,10-/m1/s1 |
| InChIKey | SIYIWRBXVOLPQM-LCFZEIEZSA-N |
| XLogP | -1.98 |
| TPSA | 284.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.22 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|