C13H21N2O18P3 — CID 175325848
2-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethoxy]acetic acid (PubChem CID 175325848) has the molecular formula C13H21N2O18P3 and a molecular weight of 586.23 g/mol. Its IUPAC name is 2-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 175325848 |
| Molecular Formula | C13H21N2O18P3 |
| Molecular Weight | 586.23 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 2-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21N2O18P3/c16-8(17)5-29-2-1-6-3-15(13(21)14-11(6)20)12-10(19)9(18)7(31-12)4-30-35(25,26)33-36(27,28)32-34(22,23)24/h3,7,9-10,12,18-19H,1-2,4-5H2,(H,16,17)(H,25,26)(H,27,28)(H,14,20,21)(H2,22,23,24)/t7-,9-,10-,12-/m1/s1 |
| InChIKey | QASIWLDWBURCTH-UGKPPGOTSA-N |
| XLogP | -2.86 |
| TPSA | 310.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.23 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|