C9H14N2O12P2S — CID 71438676
[5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 71438676) has the molecular formula C9H14N2O12P2S and a molecular weight of 436.23 g/mol. Its IUPAC name is [5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 71438676 |
| Molecular Formula | C9H14N2O12P2S |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | [5-(2,4-dioxo-5-sulfanylpyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n(C2OC(COP(=O)(O)OP(=O)(O)O)C(O)C2O)cc1S |
| InChI | InChI=1S/C9H14N2O12P2S/c12-5-3(2-21-25(19,20)23-24(16,17)18)22-8(6(5)13)11-1-4(26)7(14)10-9(11)15/h1,3,5-6,8,12-13,26H,2H2,(H,19,20)(H,10,14,15)(H2,16,17,18) |
| InChIKey | YHJRHKRHTXEHAQ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 217.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|