C12H19N2O17P3 — CID 90230869
methyl 2-[1-[(2R,3S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetate (PubChem CID 90230869) has the molecular formula C12H19N2O17P3 and a molecular weight of 556.20 g/mol. Its IUPAC name is methyl 2-[1-[(2R,3S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetate.
| Compound Name | methyl 2-[1-[(2R,3S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetate |
|---|---|
| PubChem CID | 90230869 |
| Molecular Formula | C12H19N2O17P3 |
| Molecular Weight | 556.20 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | methyl 2-[1-[(2R,3S,5R)-3,4-dihydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetate |
| SMILES | COC(=O)Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19N2O17P3/c1-27-7(15)2-5-3-14(12(19)13-10(5)18)11-9(17)8(16)6(29-11)4-28-33(23,24)31-34(25,26)30-32(20,21)22/h3,6,8-9,11,16-17H,2,4H2,1H3,(H,23,24)(H,25,26)(H,13,18,19)(H2,20,21,22)/t6-,8?,9+,11-/m1/s1 |
| InChIKey | NWUGTIWYSOREPP-DZNMIZDJSA-N |
| XLogP | -2.79 |
| TPSA | 290.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.20 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|