C12H21N3O12P2 — CID 10575974
[(2R,3S,4R,5R)-5-[5-(3-aminopropyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 10575974) has the molecular formula C12H21N3O12P2 and a molecular weight of 461.26 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-(3-aminopropyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-(3-aminopropyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10575974 |
| Molecular Formula | C12H21N3O12P2 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-(3-aminopropyl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | NCCCc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H21N3O12P2/c13-3-1-2-6-4-15(12(19)14-10(6)18)11-9(17)8(16)7(26-11)5-25-29(23,24)27-28(20,21)22/h4,7-9,11,16-17H,1-3,5,13H2,(H,23,24)(H,14,18,19)(H2,20,21,22)/t7-,8-,9-,11-/m1/s1 |
| InChIKey | BJDONNJGJWOVDK-TURQNECASA-N |
| XLogP | -2.73 |
| TPSA | 243.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|