C13H16N2O13P2 — CID 123550972
[(2R,3S,4R,5R)-5-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 123550972) has the molecular formula C13H16N2O13P2 and a molecular weight of 470.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123550972 |
| Molecular Formula | C13H16N2O13P2 |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)cc1-c1ccco1 |
| InChI | InChI=1S/C13H16N2O13P2/c16-9-8(5-26-30(23,24)28-29(20,21)22)27-12(10(9)17)15-4-6(7-2-1-3-25-7)11(18)14-13(15)19/h1-4,8-10,12,16-17H,5H2,(H,23,24)(H,14,18,19)(H2,20,21,22)/t8-,9-,10-,12-/m1/s1 |
| InChIKey | VJKQUOGGRSPKFJ-DNRKLUKYSA-N |
| XLogP | -1.36 |
| TPSA | 230.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|