C21H23N2O15P3S — CID 54488166
[[(2R,3S,4R,5R)-5-[2,4-dioxo-5-(4-phenylphenyl)sulfanylpyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 54488166) has the molecular formula C21H23N2O15P3S and a molecular weight of 668.40 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2,4-dioxo-5-(4-phenylphenyl)sulfanylpyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[2,4-dioxo-5-(4-phenylphenyl)sulfanylpyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 54488166 |
| Molecular Formula | C21H23N2O15P3S |
| Molecular Weight | 668.40 g/mol |
| Exact Mass | 668.00 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2,4-dioxo-5-(4-phenylphenyl)sulfanylpyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)cc1Sc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N2O15P3S/c24-17-15(11-35-40(31,32)38-41(33,34)37-39(28,29)30)36-20(18(17)25)23-10-16(19(26)22-21(23)27)42-14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-10,15,17-18,20,24-25H,11H2,(H,31,32)(H,33,34)(H,22,26,27)(H2,28,29,30)/t15-,17-,18-,20-/m1/s1 |
| InChIKey | XTVFFYRXYZVFNF-DLVXIWMQSA-N |
| XLogP | 1.32 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|