C8H12N3O9P — CID 90161209
[(2R,3S,4R,5R)-5-(2,4-dioxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90161209) has the molecular formula C8H12N3O9P and a molecular weight of 325.17 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90161209 |
| Molecular Formula | C8H12N3O9P |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxo-1,3,5-triazin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1ncn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N3O9P/c12-4-3(1-19-21(16,17)18)20-6(5(4)13)11-2-9-7(14)10-8(11)15/h2-6,12-13H,1H2,(H,10,14,15)(H2,16,17,18)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | IHQNJHYBJLOKGX-KVTDHHQDSA-N |
| XLogP | -3.34 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|