C9H13N2Na2O9P — CID 123134060
Uridine 5'-monophosphate, disodium salt (PubChem CID 123134060) has the molecular formula C9H13N2Na2O9P and a molecular weight of 370.16 g/mol.
| Compound Name | Uridine 5'-monophosphate, disodium salt |
|---|---|
| PubChem CID | 123134060 |
| Molecular Formula | C9H13N2Na2O9P |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | — |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1.[Na].[Na] |
| InChI | InChI=1S/C9H13N2O9P.2Na/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;;/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18);;/t4-,6-,7-,8-;;/m1../s1 |
| InChIKey | RSSRHKDOIOBLBS-WFIJOQBCSA-N |
| XLogP | -3.50 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|