C13H17N4O9P — CID 67059729
[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;pyrimidine (PubChem CID 67059729) has the molecular formula C13H17N4O9P and a molecular weight of 404.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;pyrimidine.
| Compound Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;pyrimidine |
|---|---|
| PubChem CID | 67059729 |
| Molecular Formula | C13H17N4O9P |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;pyrimidine |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1.c1cncnc1 |
| InChI | InChI=1S/C9H13N2O9P.C4H4N2/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;1-2-5-4-6-3-1/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18);1-4H/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | RJBJPBNVBZZPDI-IAIGYFSYSA-N |
| XLogP | -2.26 |
| TPSA | 197.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|