C9H12N2NaO9P — CID 44659300
sodium [(2S,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 44659300) has the molecular formula C9H12N2NaO9P and a molecular weight of 346.16 g/mol. Its IUPAC name is sodium [(2S,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | sodium [(2S,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 44659300 |
| Molecular Formula | C9H12N2NaO9P |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | sodium [(2S,3R,4R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | O=c1ccn(C2O[C@@H](COP(=O)([O-])O)[C@H](O)[C@H]2O)c(=O)[nH]1.[Na+] |
| InChI | InChI=1S/C9H13N2O9P.Na/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;/h1-2,4,6-8,13-14H,3H2,(H,10,12,15)(H2,16,17,18);/q;+1/p-1/t4-,6-,7+,8?;/m0./s1 |
| InChIKey | WHRWYTJLFJEXDD-JXAVVIDVSA-M |
| XLogP | -6.36 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | -6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|