C19H29N3O7 — CID 175676775
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-hexyltriazol-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 175676775) has the molecular formula C19H29N3O7 and a molecular weight of 411.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-hexyltriazol-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-hexyltriazol-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 175676775 |
| Molecular Formula | C19H29N3O7 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-hexyltriazol-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCCCc1cn([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)nn1 |
| InChI | InChI=1S/C19H29N3O7/c1-5-6-7-8-9-15-10-22(21-20-15)19-18(28-14(4)25)17(27-13(3)24)16(29-19)11-26-12(2)23/h10,16-19H,5-9,11H2,1-4H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | BOOQYPAVWFXKCM-NCXUSEDFSA-N |
| XLogP | 1.72 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|