C25H25N3O7 — CID 71623852
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(4-phenylphenyl)triazol-1-yl]oxolan-2-yl]methyl acetate (PubChem CID 71623852) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(4-phenylphenyl)triazol-1-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(4-phenylphenyl)triazol-1-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71623852 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[4-(4-phenylphenyl)triazol-1-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(-c3ccc(-c4ccccc4)cc3)nn2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H25N3O7/c1-15(29)32-14-22-23(33-16(2)30)24(34-17(3)31)25(35-22)28-13-21(26-27-28)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-13,22-25H,14H2,1-3H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | RGTZZVRSNSFKAC-ZGFBMJKBSA-N |
| XLogP | 2.94 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|