C43H49N3O13 — CID 170858228
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 170858228) has the molecular formula C43H49N3O13 and a molecular weight of 815.87 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 170858228 |
| Molecular Formula | C43H49N3O13 |
| Molecular Weight | 815.87 g/mol |
| Exact Mass | 815.33 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[(2S,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc([C@@H]3O[C@@H](C)[C@@H](OCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C43H49N3O13/c1-26-36(52-22-31-15-9-6-10-16-31)39(53-23-32-17-11-7-12-18-32)40(54-24-33-19-13-8-14-20-33)37(55-26)34-21-46(45-44-34)43-42(58-30(5)50)41(57-29(4)49)38(56-28(3)48)35(59-43)25-51-27(2)47/h6-21,26,35-43H,22-25H2,1-5H3/t26-,35+,36+,37-,38-,39+,40+,41-,42+,43+/m0/s1 |
| InChIKey | JTCRFXSFJXIMBP-FHNXOJSVSA-N |
| XLogP | 4.75 |
| TPSA | 182.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.87 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|