C35H44O13S — CID 14131772
[(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4R,5S,6S)-6-methyl-2-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 14131772) has the molecular formula C35H44O13S and a molecular weight of 704.79 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4R,5S,6S)-6-methyl-2-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4R,5S,6S)-6-methyl-2-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14131772 |
| Molecular Formula | C35H44O13S |
| Molecular Weight | 704.79 g/mol |
| Exact Mass | 704.25 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,4,5-triacetyloxy-6-[(2S,3R,4R,5S,6S)-6-methyl-2-methylsulfanyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CS[C@@H]1O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1O[C@@H]1O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C35H44O13S/c1-20-28(41-17-25-13-9-7-10-14-25)30(42-18-26-15-11-8-12-16-26)33(35(43-20)49-6)48-34-32(46-24(5)39)31(45-23(4)38)29(44-22(3)37)27(47-34)19-40-21(2)36/h7-16,20,27-35H,17-19H2,1-6H3/t20-,27-,28-,29-,30+,31+,32+,33+,34-,35-/m0/s1 |
| InChIKey | ZBZYODJCYFCVIZ-LSENIDBSSA-N |
| XLogP | 3.73 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|