C34H49N3O9 — CID 71541581
[(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-(4-phenyltriazol-1-yl)oxan-2-yl]methyl pentanoate (PubChem CID 71541581) has the molecular formula C34H49N3O9 and a molecular weight of 643.78 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-(4-phenyltriazol-1-yl)oxan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-(4-phenyltriazol-1-yl)oxan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 71541581 |
| Molecular Formula | C34H49N3O9 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-(4-phenyltriazol-1-yl)oxan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1O[C@@H](n2cc(-c3ccccc3)nn2)[C@H](OC(=O)CCCC)[C@@H](OC(=O)CCCC)[C@@H]1OC(=O)CCCC |
| InChI | InChI=1S/C34H49N3O9/c1-5-9-18-27(38)42-23-26-31(44-28(39)19-10-6-2)32(45-29(40)20-11-7-3)33(46-30(41)21-12-8-4)34(43-26)37-22-25(35-36-37)24-16-14-13-15-17-24/h13-17,22,26,31-34H,5-12,18-21,23H2,1-4H3/t26-,31-,32+,33-,34-/m1/s1 |
| InChIKey | SRPPNMFZLQIGHA-VQHOHFBQSA-N |
| XLogP | 5.88 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|