C27H42N2O9 — CID 101181117
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(hexanoyloxy)oxolan-2-yl]methyl hexanoate (PubChem CID 101181117) has the molecular formula C27H42N2O9 and a molecular weight of 538.64 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(hexanoyloxy)oxolan-2-yl]methyl hexanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(hexanoyloxy)oxolan-2-yl]methyl hexanoate |
|---|---|
| PubChem CID | 101181117 |
| Molecular Formula | C27H42N2O9 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-di(hexanoyloxy)oxolan-2-yl]methyl hexanoate |
| SMILES | CCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C27H42N2O9/c1-4-7-10-13-21(31)35-18-19-24(37-22(32)14-11-8-5-2)25(38-23(33)15-12-9-6-3)26(36-19)29-17-16-20(30)28-27(29)34/h16-17,19,24-26H,4-15,18H2,1-3H3,(H,28,30,34)/t19-,24-,25-,26-/m1/s1 |
| InChIKey | XVWFDTSLWOLZJG-UJTWYAIMSA-N |
| XLogP | 3.54 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|