C33H59N3O6Si — CID 71535240
[(2R,3R,4S,5S)-4-amino-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (Z)-octadec-9-enoate (PubChem CID 71535240) has the molecular formula C33H59N3O6Si and a molecular weight of 621.94 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4-amino-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2R,3R,4S,5S)-4-amino-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 71535240 |
| Molecular Formula | C33H59N3O6Si |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | [(2R,3R,4S,5S)-4-amino-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@@H]1[C@@H](N)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C33H59N3O6Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(38)42-30-29(34)26(25-40-43(5,6)33(2,3)4)41-31(30)36-24-23-27(37)35-32(36)39/h14-15,23-24,26,29-31H,7-13,16-22,25,34H2,1-6H3,(H,35,37,39)/b15-14-/t26-,29+,30-,31-/m1/s1 |
| InChIKey | SWSINQSVVCCKKE-ZYOXICDZSA-N |
| XLogP | 6.73 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|