C21H32N2O8 — CID 101181118
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hexanoyloxy-2-(hydroxymethyl)oxolan-3-yl] hexanoate (PubChem CID 101181118) has the molecular formula C21H32N2O8 and a molecular weight of 440.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hexanoyloxy-2-(hydroxymethyl)oxolan-3-yl] hexanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hexanoyloxy-2-(hydroxymethyl)oxolan-3-yl] hexanoate |
|---|---|
| PubChem CID | 101181118 |
| Molecular Formula | C21H32N2O8 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hexanoyloxy-2-(hydroxymethyl)oxolan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@H]1[C@H](OC(=O)CCCCC)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C21H32N2O8/c1-3-5-7-9-16(26)30-18-14(13-24)29-20(23-12-11-15(25)22-21(23)28)19(18)31-17(27)10-8-6-4-2/h11-12,14,18-20,24H,3-10,13H2,1-2H3,(H,22,25,28)/t14-,18-,19-,20-/m1/s1 |
| InChIKey | VDGBQVAVVRBEQQ-LMFCIFFHSA-N |
| XLogP | 1.41 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|