C52H93N3O12P+ — CID 11535436
2-[2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-2-yl]methoxy]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 11535436) has the molecular formula C52H93N3O12P+ and a molecular weight of 983.30 g/mol. Its IUPAC name is 2-[2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-2-yl]methoxy]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-2-yl]methoxy]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11535436 |
| Molecular Formula | C52H93N3O12P+ |
| Molecular Weight | 983.30 g/mol |
| Exact Mass | 982.65 |
| IUPAC Name | 2-[2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-bis[[(Z)-octadec-9-enoyl]oxy]oxolan-2-yl]methoxy]ethoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@@H]1[C@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@@H](COCCOP(=O)(O)OCC[N+](C)(C)C)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C52H92N3O12P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-47(57)66-49-45(44-62-42-43-64-68(60,61)63-41-40-55(3,4)5)65-51(54-39-38-46(56)53-52(54)59)50(49)67-48(58)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,38-39,45,49-51H,6-19,24-37,40-44H2,1-5H3,(H-,53,56,59,60,61)/p+1/b22-20-,23-21-/t45-,49-,50-,51-/m1/s1 |
| InChIKey | XJVYXBDKGVVPJC-LPIOPLTPSA-O |
| XLogP | 11.19 |
| TPSA | 181.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.30 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|