C32H65NO7P+ — CID 165194438
2-[hydroxy-[3-[(Z)-tridec-9-enoxy]-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165194438) has the molecular formula C32H65NO7P+ and a molecular weight of 606.85 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(Z)-tridec-9-enoxy]-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(Z)-tridec-9-enoxy]-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165194438 |
| Molecular Formula | C32H65NO7P+ |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.45 |
| IUPAC Name | 2-[hydroxy-[3-[(Z)-tridec-9-enoxy]-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC/C=C\CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C32H64NO7P/c1-6-8-10-12-14-16-17-18-20-22-24-27-37-29-31(30-39-41(35,36)38-28-26-33(3,4)5)40-32(34)25-23-21-19-15-13-11-9-7-2/h10,12,31H,6-9,11,13-30H2,1-5H3/p+1/b12-10- |
| InChIKey | CCXGTVSUKRBRCP-BENRWUELSA-O |
| XLogP | 8.37 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|