C24H51NO4P+ — CID 11744356
2-[hydroxy-[(Z)-nonadec-10-enoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 11744356) has the molecular formula C24H51NO4P+ and a molecular weight of 448.65 g/mol. Its IUPAC name is 2-[hydroxy-[(Z)-nonadec-10-enoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(Z)-nonadec-10-enoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 11744356 |
| Molecular Formula | C24H51NO4P+ |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 2-[hydroxy-[(Z)-nonadec-10-enoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C24H50NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-28-30(26,27)29-24-22-25(2,3)4/h12-13H,5-11,14-24H2,1-4H3/p+1/b13-12- |
| InChIKey | IYFNQKVULRQSGW-SEYXRHQNSA-O |
| XLogP | 7.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|