C14H31NO4P+ — CID 87338323
2-[hydroxy(non-1-enoxy)phosphoryl]oxyethyl-trimethylazanium (PubChem CID 87338323) has the molecular formula C14H31NO4P+ and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[hydroxy(non-1-enoxy)phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy(non-1-enoxy)phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87338323 |
| Molecular Formula | C14H31NO4P+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-[hydroxy(non-1-enoxy)phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC=COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C14H30NO4P/c1-5-6-7-8-9-10-11-13-18-20(16,17)19-14-12-15(2,3)4/h11,13H,5-10,12,14H2,1-4H3/p+1 |
| InChIKey | LZAZXKISJNDPPM-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|