About bis(hept-1-enyl) hydrogen phosphate
bis(hept-1-enyl) hydrogen phosphate (PubChem CID 54526218) has the molecular formula C14H27O4P
and a molecular weight of 290.34 g/mol. Its IUPAC name is bis(hept-1-enyl) hydrogen phosphate.
Molecular Properties
| Compound Name | bis(hept-1-enyl) hydrogen phosphate |
| PubChem CID | 54526218 |
| Molecular Formula | C14H27O4P |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | bis(hept-1-enyl) hydrogen phosphate |
| SMILES | CCCCCC=COP(=O)(O)OC=CCCCCC |
| InChI | InChI=1S/C14H27O4P/c1-3-5-7-9-11-13-17-19(15,16)18-14-12-10-8-6-4-2/h11-14H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | YTGSUJSZLYJVEH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(hept-1-enyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hept-1-enyl) hydrogen phosphate?
The IUPAC name of bis(hept-1-enyl) hydrogen phosphate (CID 54526218) is bis(hept-1-enyl) hydrogen phosphate.
What is the SMILES notation for bis(hept-1-enyl) hydrogen phosphate?
The canonical SMILES for bis(hept-1-enyl) hydrogen phosphate is CCCCCC=COP(=O)(O)OC=CCCCCC.
What is the InChIKey of bis(hept-1-enyl) hydrogen phosphate?
The InChIKey is YTGSUJSZLYJVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27O4P/c1-3-5-7-9-11-13-17-19(15,16)18-14-12-10-8-6-4-2/h11-14H,3-10H2,1-2H3,(H,15,16).
What are the key properties of bis(hept-1-enyl) hydrogen phosphate?
bis(hept-1-enyl) hydrogen phosphate has a molecular weight of 290.34 g/mol, XLogP of 5.31, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hept-1-enyl) hydrogen phosphate is sourced from PubChem (CID 54526218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).