C48H93O12P3 — CID 160525345
bis(hept-1-enyl) hydrogen phosphate;bis(non-1-enyl) hydrogen phosphate;bis(oct-1-enyl) hydrogen phosphate (PubChem CID 160525345) has the molecular formula C48H93O12P3 and a molecular weight of 955.18 g/mol. Its IUPAC name is bis(hept-1-enyl) hydrogen phosphate;bis(non-1-enyl) hydrogen phosphate;bis(oct-1-enyl) hydrogen phosphate.
| Compound Name | bis(hept-1-enyl) hydrogen phosphate;bis(non-1-enyl) hydrogen phosphate;bis(oct-1-enyl) hydrogen phosphate |
|---|---|
| PubChem CID | 160525345 |
| Molecular Formula | C48H93O12P3 |
| Molecular Weight | 955.18 g/mol |
| Exact Mass | 954.59 |
| IUPAC Name | bis(hept-1-enyl) hydrogen phosphate;bis(non-1-enyl) hydrogen phosphate;bis(oct-1-enyl) hydrogen phosphate |
| SMILES | CCCCCC=COP(=O)(O)OC=CCCCCC.CCCCCCC=COP(=O)(O)OC=CCCCCCC.CCCCCCCC=COP(=O)(O)OC=CCCCCCCC |
| InChI | InChI=1S/C18H35O4P.C16H31O4P.C14H27O4P/c1-3-5-7-9-11-13-15-17-21-23(19,20)22-18-16-14-12-10-8-6-4-2;1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;1-3-5-7-9-11-13-17-19(15,16)18-14-12-10-8-6-4-2/h15-18H,3-14H2,1-2H3,(H,19,20);13-16H,3-12H2,1-2H3,(H,17,18);11-14H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | QUUUMTQROSGVQB-UHFFFAOYSA-N |
| XLogP | 18.26 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.18 |
| LogP ≤ 5 | 18.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|