C25H52NO4P — CID 58922700
[(Z)-icos-11-enyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 58922700) has the molecular formula C25H52NO4P and a molecular weight of 461.67 g/mol. Its IUPAC name is [(Z)-icos-11-enyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(Z)-icos-11-enyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 58922700 |
| Molecular Formula | C25H52NO4P |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.36 |
| IUPAC Name | [(Z)-icos-11-enyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCOP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C25H52NO4P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-29-31(27,28)30-25-23-26(2,3)4/h12-13H,5-11,14-25H2,1-4H3/b13-12- |
| InChIKey | FEMJJZKNBWBNPB-SEYXRHQNSA-N |
| XLogP | 7.01 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|