About 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate
3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134978552) has the molecular formula C18H40NO5P
and a molecular weight of 381.49 g/mol. Its IUPAC name is 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate.
Molecular Properties
| Compound Name | 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| PubChem CID | 134978552 |
| Molecular Formula | C18H40NO5P |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCCOCCCOP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C18H40NO5P/c1-5-6-7-8-9-10-11-12-15-22-16-13-17-23-25(20,21)24-18-14-19(2,3)4/h5-18H2,1-4H3 |
| InChIKey | NKVDJZLENIEMSF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate?
The IUPAC name of 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate (CID 134978552) is 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate.
What is the SMILES notation for 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate?
The canonical SMILES for 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate is CCCCCCCCCCOCCCOP(=O)([O-])OCC[N+](C)(C)C.
What is the InChIKey of 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate?
The InChIKey is NKVDJZLENIEMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40NO5P/c1-5-6-7-8-9-10-11-12-15-22-16-13-17-23-25(20,21)24-18-14-19(2,3)4/h5-18H2,1-4H3.
What are the key properties of 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate?
3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate has a molecular weight of 381.49 g/mol, XLogP of 3.74, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decoxypropyl 2-(trimethylazaniumyl)ethyl phosphate is sourced from PubChem (CID 134978552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).