C22H30N2O13P2 — CID 21059422
[2-(2,4-dioxopyrimidin-1-yl)-5-[[[hexoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] benzoate (PubChem CID 21059422) has the molecular formula C22H30N2O13P2 and a molecular weight of 592.43 g/mol. Its IUPAC name is [2-(2,4-dioxopyrimidin-1-yl)-5-[[[hexoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] benzoate.
| Compound Name | [2-(2,4-dioxopyrimidin-1-yl)-5-[[[hexoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 21059422 |
| Molecular Formula | C22H30N2O13P2 |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | [2-(2,4-dioxopyrimidin-1-yl)-5-[[[hexoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] benzoate |
| SMILES | CCCCCCOP(=O)(O)OP(=O)(O)OCC1OC(n2ccc(=O)[nH]c2=O)C(OC(=O)c2ccccc2)C1O |
| InChI | InChI=1S/C22H30N2O13P2/c1-2-3-4-8-13-33-38(29,30)37-39(31,32)34-14-16-18(26)19(36-21(27)15-9-6-5-7-10-15)20(35-16)24-12-11-17(25)23-22(24)28/h5-7,9-12,16,18-20,26H,2-4,8,13-14H2,1H3,(H,29,30)(H,31,32)(H,23,25,28) |
| InChIKey | BGKXWYIANGVWDY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 212.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|