C12H20N2O13P2 — CID 133084070
[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 3-hydroxypropyl hydrogen phosphate (PubChem CID 133084070) has the molecular formula C12H20N2O13P2 and a molecular weight of 462.24 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 3-hydroxypropyl hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 3-hydroxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 133084070 |
| Molecular Formula | C12H20N2O13P2 |
| Molecular Weight | 462.24 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] 3-hydroxypropyl hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCCCO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H20N2O13P2/c15-4-1-5-24-28(20,21)27-29(22,23)25-6-7-9(17)10(18)11(26-7)14-3-2-8(16)13-12(14)19/h2-3,7,9-11,15,17-18H,1,4-6H2,(H,20,21)(H,22,23)(H,13,16,19)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | PBUQAJCOSUSWDW-QCNRFFRDSA-N |
| XLogP | -2.21 |
| TPSA | 227.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|