C16H25N5O16P2 — CID 89271056
[[(3R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 89271056) has the molecular formula C16H25N5O16P2 and a molecular weight of 605.34 g/mol. Its IUPAC name is [[(3R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [[(3R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 89271056 |
| Molecular Formula | C16H25N5O16P2 |
| Molecular Weight | 605.34 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | [[(3R)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]methoxy-hydroxyphosphoryl] [(2R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | [N-]=[N+]=NCC1OC(COP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)C(O)C2O)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C16H25N5O16P2/c17-20-18-3-6-10(23)13(26)11(24)7(35-6)4-33-38(29,30)37-39(31,32)34-5-8-12(25)14(27)15(36-8)21-2-1-9(22)19-16(21)28/h1-2,6-8,10-15,23-27H,3-5H2,(H,29,30)(H,31,32)(H,19,22,28)/t6?,7?,8-,10?,11+,12?,13?,14?,15-/m1/s1 |
| InChIKey | DLROQBXNSDSKCF-MWNNTNKHSA-N |
| XLogP | -3.43 |
| TPSA | 325.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.34 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|