C23H21N2O10PS — CID 11577545
[(2R,3R,4R,5R)-4-benzoyloxy-2-(dihydroxyphosphinothioyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 11577545) has the molecular formula C23H21N2O10PS and a molecular weight of 548.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-benzoyloxy-2-(dihydroxyphosphinothioyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-4-benzoyloxy-2-(dihydroxyphosphinothioyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11577545 |
| Molecular Formula | C23H21N2O10PS |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | [(2R,3R,4R,5R)-4-benzoyloxy-2-(dihydroxyphosphinothioyloxymethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@H](OC(=O)c2ccccc2)[C@@H](COP(O)(O)=S)O[C@H]1n1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C23H21N2O10PS/c26-17-11-12-25(23(29)24-17)20-19(35-22(28)15-9-5-2-6-10-15)18(16(33-20)13-32-36(30,31)37)34-21(27)14-7-3-1-4-8-14/h1-12,16,18-20H,13H2,(H,24,26,29)(H2,30,31,37)/t16-,18-,19-,20-/m1/s1 |
| InChIKey | IKLKYSNNEPJJIB-VBSBHUPXSA-N |
| XLogP | 1.11 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|