C16H14N2O6 — CID 98508069
[(1S,2S,4R,5R)-4-(2,4-dioxopyrimidin-1-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate (PubChem CID 98508069) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-4-(2,4-dioxopyrimidin-1-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate.
| Compound Name | [(1S,2S,4R,5R)-4-(2,4-dioxopyrimidin-1-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 98508069 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | [(1S,2S,4R,5R)-4-(2,4-dioxopyrimidin-1-yl)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]2O[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O6/c19-11-6-7-18(16(21)17-11)14-13-12(24-13)10(23-14)8-22-15(20)9-4-2-1-3-5-9/h1-7,10,12-14H,8H2,(H,17,19,21)/t10-,12-,13+,14+/m0/s1 |
| InChIKey | WKMZPURUSZTWHP-SCUASFONSA-N |
| XLogP | 0.06 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|