C16H15FN2O5 — CID 96884537
[(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methyl benzoate (PubChem CID 96884537) has the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 96884537 |
| Molecular Formula | C16H15FN2O5 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [(2R,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-fluorooxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@H]1F)c1ccccc1 |
| InChI | InChI=1S/C16H15FN2O5/c17-11-8-14(19-7-6-13(20)18-16(19)22)24-12(11)9-23-15(21)10-4-2-1-3-5-10/h1-7,11-12,14H,8-9H2,(H,18,20,22)/t11-,12-,14-/m1/s1 |
| InChIKey | XTXHNFKYFXCAOQ-YRGRVCCFSA-N |
| XLogP | 1.02 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |