C16H18N4O4 — CID 10735166
N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]benzamide (PubChem CID 10735166) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]benzamide.
| Compound Name | N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10735166 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]benzamide |
| SMILES | N[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N4O4/c17-11-8-14(20-7-6-13(21)19-16(20)23)24-12(11)9-18-15(22)10-4-2-1-3-5-10/h1-7,11-12,14H,8-9,17H2,(H,18,22)(H,19,21,23)/t11-,12+,14+/m0/s1 |
| InChIKey | KLXFFVDSACVOGH-OUCADQQQSA-N |
| XLogP | -0.42 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |