C10H14N4O4 — CID 10844255
N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide (PubChem CID 10844255) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide.
| Compound Name | N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 10844255 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-[[(2R,3S,5R)-3-amino-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl]formamide |
| SMILES | N[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CNC=O |
| InChI | InChI=1S/C10H14N4O4/c11-6-3-9(18-7(6)4-12-5-15)14-2-1-8(16)13-10(14)17/h1-2,5-7,9H,3-4,11H2,(H,12,15)(H,13,16,17)/t6-,7+,9+/m0/s1 |
| InChIKey | GEVVWXXMBLNUOS-LKEWCRSYSA-N |
| XLogP | -2.10 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|