C12H18N2O3 — CID 58159388
1-[(2R,5R)-4,5-diethyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 58159388) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[(2R,5R)-4,5-diethyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4,5-diethyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58159388 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-[(2R,5R)-4,5-diethyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCC1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CC |
| InChI | InChI=1S/C12H18N2O3/c1-3-8-7-11(17-9(8)4-2)14-6-5-10(15)13-12(14)16/h5-6,8-9,11H,3-4,7H2,1-2H3,(H,13,15,16)/t8?,9-,11-/m1/s1 |
| InChIKey | VIVJDHSNXCAVQA-HOGWDWRMSA-N |
| XLogP | 1.26 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |