C12H18N2O5 — CID 123691114
1-[4,5-bis(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 123691114) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-[4,5-bis(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4,5-bis(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123691114 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[4,5-bis(methoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COCC1CC(n2ccc(=O)[nH]c2=O)OC1COC |
| InChI | InChI=1S/C12H18N2O5/c1-17-6-8-5-11(19-9(8)7-18-2)14-4-3-10(15)13-12(14)16/h3-4,8-9,11H,5-7H2,1-2H3,(H,13,15,16) |
| InChIKey | SXYVQQCGYBSCEM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |