C15H28N2O5Si2 — CID 6427735
1-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 6427735) has the molecular formula C15H28N2O5Si2 and a molecular weight of 372.57 g/mol. Its IUPAC name is 1-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6427735 |
| Molecular Formula | C15H28N2O5Si2 |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-[(4R,5S)-4-trimethylsilyloxy-5-(trimethylsilyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)OC[C@@H]1OC(n2ccc(=O)[nH]c2=O)C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H28N2O5Si2/c1-23(2,3)20-10-12-11(22-24(4,5)6)9-14(21-12)17-8-7-13(18)16-15(17)19/h7-8,11-12,14H,9-10H2,1-6H3,(H,16,18,19)/t11-,12+,14?/m1/s1 |
| InChIKey | UWMUHCLOWACYQQ-RJTITELWSA-N |
| XLogP | 1.90 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|