C11H16N2O9S2 — CID 11246083
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate (PubChem CID 11246083) has the molecular formula C11H16N2O9S2 and a molecular weight of 384.39 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11246083 |
| Molecular Formula | C11H16N2O9S2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methylsulfonyloxyoxolan-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C11H16N2O9S2/c1-23(16,17)20-6-8-7(22-24(2,18)19)5-10(21-8)13-4-3-9(14)12-11(13)15/h3-4,7-8,10H,5-6H2,1-2H3,(H,12,14,15)/t7-,8+,10+/m0/s1 |
| InChIKey | SJTIOKCFMIKFPY-QXFUBDJGSA-N |
| XLogP | -1.85 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|