C12H15ClN2O8S — CID 121002322
[(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 121002322) has the molecular formula C12H15ClN2O8S and a molecular weight of 382.78 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 121002322 |
| Molecular Formula | C12H15ClN2O8S |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | [(2R,3R,4R,5R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-2-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](Cl)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C12H15ClN2O8S/c1-6(16)22-10-7(5-21-24(2,19)20)23-11(9(10)13)15-4-3-8(17)14-12(15)18/h3-4,7,9-11H,5H2,1-2H3,(H,14,17,18)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | GRIFZFXKTGBVQB-QCNRFFRDSA-N |
| XLogP | -1.05 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|