C13H18N2O8S — CID 14562047
[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate (PubChem CID 14562047) has the molecular formula C13H18N2O8S and a molecular weight of 362.36 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 14562047 |
| Molecular Formula | C13H18N2O8S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(C)(=O)=O)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H18N2O8S/c1-13(2)22-9-7(6-20-24(3,18)19)21-11(10(9)23-13)15-5-4-8(16)14-12(15)17/h4-5,7,9-11H,6H2,1-3H3,(H,14,16,17)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | UPDXJUVQOLRFDB-QCNRFFRDSA-N |
| XLogP | -1.07 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|