C20H28N2O7S2 — CID 59994189
[(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 59994189) has the molecular formula C20H28N2O7S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 59994189 |
| Molecular Formula | C20H28N2O7S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COC(=O)CCCCC1CCSS1)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C20H28N2O7S2/c1-20(2)28-16-13(11-26-15(24)6-4-3-5-12-8-10-30-31-12)27-18(17(16)29-20)22-9-7-14(23)21-19(22)25/h7,9,12-13,16-18H,3-6,8,10-11H2,1-2H3,(H,21,23,25)/t12?,13-,16-,17-,18-/m1/s1 |
| InChIKey | OYTUNBCHHAPPGH-CWCNFMNOSA-N |
| XLogP | 2.21 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|