C14H19N2O7- — CID 59545000
2-[[(3aS,4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]ethanolate (PubChem CID 59545000) has the molecular formula C14H19N2O7- and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-[[(3aS,4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]ethanolate.
| Compound Name | 2-[[(3aS,4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]ethanolate |
|---|---|
| PubChem CID | 59545000 |
| Molecular Formula | C14H19N2O7- |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[[(3aS,4R,6R)-4-(2,4-dioxopyrimidin-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]ethanolate |
| SMILES | CC1(C)OC2[C@@H](COCC[O-])O[C@@H](n3ccc(=O)[nH]c3=O)[C@H]2O1 |
| InChI | InChI=1S/C14H19N2O7/c1-14(2)22-10-8(7-20-6-5-17)21-12(11(10)23-14)16-4-3-9(18)15-13(16)19/h3-4,8,10-12H,5-7H2,1-2H3,(H,15,18,19)/q-1/t8-,10?,11+,12-/m1/s1 |
| InChIKey | IHDVCOSGRRITRX-LABGDYGKSA-N |
| XLogP | -1.67 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|